C11H15F5O2 — CID 104752153
1-cyclohexyl-2-(2,2,3,3,3-pentafluoropropoxy)ethanone (PubChem CID 104752153) has the molecular formula C11H15F5O2 and a molecular weight of 274.23 g/mol. Its IUPAC name is 1-cyclohexyl-2-(2,2,3,3,3-pentafluoropropoxy)ethanone.
| Compound Name | 1-cyclohexyl-2-(2,2,3,3,3-pentafluoropropoxy)ethanone |
|---|---|
| PubChem CID | 104752153 |
| Molecular Formula | C11H15F5O2 |
| Molecular Weight | 274.23 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 1-cyclohexyl-2-(2,2,3,3,3-pentafluoropropoxy)ethanone |
| SMILES | O=C(COCC(F)(F)C(F)(F)F)C1CCCCC1 |
| InChI | InChI=1S/C11H15F5O2/c12-10(13,11(14,15)16)7-18-6-9(17)8-4-2-1-3-5-8/h8H,1-7H2 |
| InChIKey | MYEQKCALOOFBJE-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.23 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|