About 1-(oxolan-3-yl)-2-(3,3,3-trifluoropropoxy)ethanone
1-(oxolan-3-yl)-2-(3,3,3-trifluoropropoxy)ethanone (PubChem CID 104752204) has the molecular formula C9H13F3O3
and a molecular weight of 226.19 g/mol. Its IUPAC name is 1-(oxolan-3-yl)-2-(3,3,3-trifluoropropoxy)ethanone.
Molecular Properties
| Compound Name | 1-(oxolan-3-yl)-2-(3,3,3-trifluoropropoxy)ethanone |
| PubChem CID | 104752204 |
| Molecular Formula | C9H13F3O3 |
| Molecular Weight | 226.19 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 1-(oxolan-3-yl)-2-(3,3,3-trifluoropropoxy)ethanone |
| SMILES | O=C(COCCC(F)(F)F)C1CCOC1 |
| InChI | InChI=1S/C9H13F3O3/c10-9(11,12)2-4-15-6-8(13)7-1-3-14-5-7/h7H,1-6H2 |
| InChIKey | WRFWKIJYVQVZES-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.19 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(oxolan-3-yl)-2-(3,3,3-trifluoropropoxy)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(oxolan-3-yl)-2-(3,3,3-trifluoropropoxy)ethanone?
The IUPAC name of 1-(oxolan-3-yl)-2-(3,3,3-trifluoropropoxy)ethanone (CID 104752204) is 1-(oxolan-3-yl)-2-(3,3,3-trifluoropropoxy)ethanone.
What is the SMILES notation for 1-(oxolan-3-yl)-2-(3,3,3-trifluoropropoxy)ethanone?
The canonical SMILES for 1-(oxolan-3-yl)-2-(3,3,3-trifluoropropoxy)ethanone is O=C(COCCC(F)(F)F)C1CCOC1.
What is the InChIKey of 1-(oxolan-3-yl)-2-(3,3,3-trifluoropropoxy)ethanone?
The InChIKey is WRFWKIJYVQVZES-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F3O3/c10-9(11,12)2-4-15-6-8(13)7-1-3-14-5-7/h7H,1-6H2.
What are the key properties of 1-(oxolan-3-yl)-2-(3,3,3-trifluoropropoxy)ethanone?
1-(oxolan-3-yl)-2-(3,3,3-trifluoropropoxy)ethanone has a molecular weight of 226.19 g/mol, XLogP of 1.56, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(oxolan-3-yl)-2-(3,3,3-trifluoropropoxy)ethanone is sourced from PubChem (CID 104752204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).