About 4-(oxolan-3-yl)-3H-1,3-thiazol-2-one
4-(oxolan-3-yl)-3H-1,3-thiazol-2-one (PubChem CID 104752232) has the molecular formula C7H9NO2S
and a molecular weight of 171.22 g/mol. Its IUPAC name is 4-(oxolan-3-yl)-3H-1,3-thiazol-2-one.
Molecular Properties
| Compound Name | 4-(oxolan-3-yl)-3H-1,3-thiazol-2-one |
| PubChem CID | 104752232 |
| Molecular Formula | C7H9NO2S |
| Molecular Weight | 171.22 g/mol |
| Exact Mass | 171.04 |
| IUPAC Name | 4-(oxolan-3-yl)-3H-1,3-thiazol-2-one |
| SMILES | O=c1[nH]c(C2CCOC2)cs1 |
| InChI | InChI=1S/C7H9NO2S/c9-7-8-6(4-11-7)5-1-2-10-3-5/h4-5H,1-3H2,(H,8,9) |
| InChIKey | CFBCDKJEZUENCK-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.22 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(oxolan-3-yl)-3H-1,3-thiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(oxolan-3-yl)-3H-1,3-thiazol-2-one?
The IUPAC name of 4-(oxolan-3-yl)-3H-1,3-thiazol-2-one (CID 104752232) is 4-(oxolan-3-yl)-3H-1,3-thiazol-2-one.
What is the SMILES notation for 4-(oxolan-3-yl)-3H-1,3-thiazol-2-one?
The canonical SMILES for 4-(oxolan-3-yl)-3H-1,3-thiazol-2-one is O=c1[nH]c(C2CCOC2)cs1.
What is the InChIKey of 4-(oxolan-3-yl)-3H-1,3-thiazol-2-one?
The InChIKey is CFBCDKJEZUENCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO2S/c9-7-8-6(4-11-7)5-1-2-10-3-5/h4-5H,1-3H2,(H,8,9).
What are the key properties of 4-(oxolan-3-yl)-3H-1,3-thiazol-2-one?
4-(oxolan-3-yl)-3H-1,3-thiazol-2-one has a molecular weight of 171.22 g/mol, XLogP of 0.94, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(oxolan-3-yl)-3H-1,3-thiazol-2-one is sourced from PubChem (CID 104752232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).