C12H23NO2 — CID 104752821
1-cyclopentyl-2-(1,4-oxazepan-4-yl)ethanol (PubChem CID 104752821) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is 1-cyclopentyl-2-(1,4-oxazepan-4-yl)ethanol.
| Compound Name | 1-cyclopentyl-2-(1,4-oxazepan-4-yl)ethanol |
|---|---|
| PubChem CID | 104752821 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | 1-cyclopentyl-2-(1,4-oxazepan-4-yl)ethanol |
| SMILES | OC(CN1CCCOCC1)C1CCCC1 |
| InChI | InChI=1S/C12H23NO2/c14-12(11-4-1-2-5-11)10-13-6-3-8-15-9-7-13/h11-12,14H,1-10H2 |
| InChIKey | QIBDNJKEJRFGDZ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |