About 1-cyclopentyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethanol
1-cyclopentyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethanol (PubChem CID 104752825) has the molecular formula C13H23F3N2O
and a molecular weight of 280.33 g/mol. Its IUPAC name is 1-cyclopentyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethanol.
Molecular Properties
| Compound Name | 1-cyclopentyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethanol |
| PubChem CID | 104752825 |
| Molecular Formula | C13H23F3N2O |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 1-cyclopentyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethanol |
| SMILES | OC(CN1CCN(CC(F)(F)F)CC1)C1CCCC1 |
| InChI | InChI=1S/C13H23F3N2O/c14-13(15,16)10-18-7-5-17(6-8-18)9-12(19)11-3-1-2-4-11/h11-12,19H,1-10H2 |
| InChIKey | MOXZTYOEJVBXTP-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-cyclopentyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopentyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethanol?
The IUPAC name of 1-cyclopentyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethanol (CID 104752825) is 1-cyclopentyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethanol.
What is the SMILES notation for 1-cyclopentyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethanol?
The canonical SMILES for 1-cyclopentyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethanol is OC(CN1CCN(CC(F)(F)F)CC1)C1CCCC1.
What is the InChIKey of 1-cyclopentyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethanol?
The InChIKey is MOXZTYOEJVBXTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23F3N2O/c14-13(15,16)10-18-7-5-17(6-8-18)9-12(19)11-3-1-2-4-11/h11-12,19H,1-10H2.
What are the key properties of 1-cyclopentyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethanol?
1-cyclopentyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethanol has a molecular weight of 280.33 g/mol, XLogP of 1.72, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethanol is sourced from PubChem (CID 104752825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).