About 2-[methyl(3,3,3-trifluoropropyl)amino]-1-(oxolan-3-yl)ethanol
2-[methyl(3,3,3-trifluoropropyl)amino]-1-(oxolan-3-yl)ethanol (PubChem CID 104752972) has the molecular formula C10H18F3NO2
and a molecular weight of 241.25 g/mol. Its IUPAC name is 2-[methyl(3,3,3-trifluoropropyl)amino]-1-(oxolan-3-yl)ethanol.
Molecular Properties
| Compound Name | 2-[methyl(3,3,3-trifluoropropyl)amino]-1-(oxolan-3-yl)ethanol |
| PubChem CID | 104752972 |
| Molecular Formula | C10H18F3NO2 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 2-[methyl(3,3,3-trifluoropropyl)amino]-1-(oxolan-3-yl)ethanol |
| SMILES | CN(CCC(F)(F)F)CC(O)C1CCOC1 |
| InChI | InChI=1S/C10H18F3NO2/c1-14(4-3-10(11,12)13)6-9(15)8-2-5-16-7-8/h8-9,15H,2-7H2,1H3 |
| InChIKey | LDJPLNZMMNNHQX-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[methyl(3,3,3-trifluoropropyl)amino]-1-(oxolan-3-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[methyl(3,3,3-trifluoropropyl)amino]-1-(oxolan-3-yl)ethanol?
The IUPAC name of 2-[methyl(3,3,3-trifluoropropyl)amino]-1-(oxolan-3-yl)ethanol (CID 104752972) is 2-[methyl(3,3,3-trifluoropropyl)amino]-1-(oxolan-3-yl)ethanol.
What is the SMILES notation for 2-[methyl(3,3,3-trifluoropropyl)amino]-1-(oxolan-3-yl)ethanol?
The canonical SMILES for 2-[methyl(3,3,3-trifluoropropyl)amino]-1-(oxolan-3-yl)ethanol is CN(CCC(F)(F)F)CC(O)C1CCOC1.
What is the InChIKey of 2-[methyl(3,3,3-trifluoropropyl)amino]-1-(oxolan-3-yl)ethanol?
The InChIKey is LDJPLNZMMNNHQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18F3NO2/c1-14(4-3-10(11,12)13)6-9(15)8-2-5-16-7-8/h8-9,15H,2-7H2,1H3.
What are the key properties of 2-[methyl(3,3,3-trifluoropropyl)amino]-1-(oxolan-3-yl)ethanol?
2-[methyl(3,3,3-trifluoropropyl)amino]-1-(oxolan-3-yl)ethanol has a molecular weight of 241.25 g/mol, XLogP of 1.27, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[methyl(3,3,3-trifluoropropyl)amino]-1-(oxolan-3-yl)ethanol is sourced from PubChem (CID 104752972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).