C22H24N4O3 — CID 10475622
9-hydroxy-N-[2-(2-hydroxyethylamino)ethyl]-5,6-dimethylpyrido[4,3-b]carbazole-1-carboxamide (PubChem CID 10475622) has the molecular formula C22H24N4O3 and a molecular weight of 392.46 g/mol. Its IUPAC name is 9-hydroxy-N-[2-(2-hydroxyethylamino)ethyl]-5,6-dimethylpyrido[4,3-b]carbazole-1-carboxamide.
| Compound Name | 9-hydroxy-N-[2-(2-hydroxyethylamino)ethyl]-5,6-dimethylpyrido[4,3-b]carbazole-1-carboxamide |
|---|---|
| PubChem CID | 10475622 |
| Molecular Formula | C22H24N4O3 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 9-hydroxy-N-[2-(2-hydroxyethylamino)ethyl]-5,6-dimethylpyrido[4,3-b]carbazole-1-carboxamide |
| SMILES | Cc1c2ccnc(C(=O)NCCNCCO)c2cc2c3cc(O)ccc3n(C)c12 |
| InChI | InChI=1S/C22H24N4O3/c1-13-15-5-6-24-20(22(29)25-8-7-23-9-10-27)17(15)12-18-16-11-14(28)3-4-19(16)26(2)21(13)18/h3-6,11-12,23,27-28H,7-10H2,1-2H3,(H,25,29) |
| InChIKey | YZXYCGSCNKUVML-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|