C22H23N3O4 — CID 10475669
2-(4-benzylpiperidin-1-yl)-2-oxo-N-(2-oxo-1,4-dihydro-3,1-benzoxazin-6-yl)acetamide (PubChem CID 10475669) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is 2-(4-benzylpiperidin-1-yl)-2-oxo-N-(2-oxo-1,4-dihydro-3,1-benzoxazin-6-yl)acetamide.
| Compound Name | 2-(4-benzylpiperidin-1-yl)-2-oxo-N-(2-oxo-1,4-dihydro-3,1-benzoxazin-6-yl)acetamide |
|---|---|
| PubChem CID | 10475669 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 2-(4-benzylpiperidin-1-yl)-2-oxo-N-(2-oxo-1,4-dihydro-3,1-benzoxazin-6-yl)acetamide |
| SMILES | O=C1Nc2ccc(NC(=O)C(=O)N3CCC(Cc4ccccc4)CC3)cc2CO1 |
| InChI | InChI=1S/C22H23N3O4/c26-20(23-18-6-7-19-17(13-18)14-29-22(28)24-19)21(27)25-10-8-16(9-11-25)12-15-4-2-1-3-5-15/h1-7,13,16H,8-12,14H2,(H,23,26)(H,24,28) |
| InChIKey | KVQODWLYXGVVMM-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|