C15H14BrFN2O2 — CID 104757456
N-[(5-bromo-2-fluorophenyl)methyl]-2,4-dimethyl-5-nitroaniline (PubChem CID 104757456) has the molecular formula C15H14BrFN2O2 and a molecular weight of 353.19 g/mol. Its IUPAC name is N-[(5-bromo-2-fluorophenyl)methyl]-2,4-dimethyl-5-nitroaniline.
| Compound Name | N-[(5-bromo-2-fluorophenyl)methyl]-2,4-dimethyl-5-nitroaniline |
|---|---|
| PubChem CID | 104757456 |
| Molecular Formula | C15H14BrFN2O2 |
| Molecular Weight | 353.19 g/mol |
| Exact Mass | 352.02 |
| IUPAC Name | N-[(5-bromo-2-fluorophenyl)methyl]-2,4-dimethyl-5-nitroaniline |
| SMILES | Cc1cc(C)c([N+](=O)[O-])cc1NCc1cc(Br)ccc1F |
| InChI | InChI=1S/C15H14BrFN2O2/c1-9-5-10(2)15(19(20)21)7-14(9)18-8-11-6-12(16)3-4-13(11)17/h3-7,18H,8H2,1-2H3 |
| InChIKey | WBYMGIBFQNQTSU-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.19 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|