C20H10F3N3O3 — CID 10475902
N-[2-(5,10-dioxopyrido[3,4-g]quinolin-4-yl)phenyl]-2,2,2-trifluoroacetamide (PubChem CID 10475902) has the molecular formula C20H10F3N3O3 and a molecular weight of 397.31 g/mol. Its IUPAC name is N-[2-(5,10-dioxopyrido[3,4-g]quinolin-4-yl)phenyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[2-(5,10-dioxopyrido[3,4-g]quinolin-4-yl)phenyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 10475902 |
| Molecular Formula | C20H10F3N3O3 |
| Molecular Weight | 397.31 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | N-[2-(5,10-dioxopyrido[3,4-g]quinolin-4-yl)phenyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C1c2ccncc2C(=O)c2c(-c3ccccc3NC(=O)C(F)(F)F)ccnc21 |
| InChI | InChI=1S/C20H10F3N3O3/c21-20(22,23)19(29)26-14-4-2-1-3-10(14)11-6-8-25-16-15(11)17(27)13-9-24-7-5-12(13)18(16)28/h1-9H,(H,26,29) |
| InChIKey | CHQQVSVOUCLHOY-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.31 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|