About 2-[(5-hydroxy-1,3-dihydroisoindol-2-yl)methyl]-N-[(E)-4-phenylbut-3-enyl]benzamide
2-[(5-hydroxy-1,3-dihydroisoindol-2-yl)methyl]-N-[(E)-4-phenylbut-3-enyl]benzamide (PubChem CID 10476003) has the molecular formula C26H26N2O2
and a molecular weight of 398.51 g/mol. Its IUPAC name is 2-[(5-hydroxy-1,3-dihydroisoindol-2-yl)methyl]-N-[(E)-4-phenylbut-3-enyl]benzamide.
Molecular Properties
| Compound Name | 2-[(5-hydroxy-1,3-dihydroisoindol-2-yl)methyl]-N-[(E)-4-phenylbut-3-enyl]benzamide |
| PubChem CID | 10476003 |
| Molecular Formula | C26H26N2O2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 2-[(5-hydroxy-1,3-dihydroisoindol-2-yl)methyl]-N-[(E)-4-phenylbut-3-enyl]benzamide |
| SMILES | O=C(NCC/C=C/c1ccccc1)c1ccccc1CN1Cc2ccc(O)cc2C1 |
| InChI | InChI=1S/C26H26N2O2/c29-24-14-13-21-17-28(19-23(21)16-24)18-22-11-4-5-12-25(22)26(30)27-15-7-6-10-20-8-2-1-3-9-20/h1-6,8-14,16,29H,7,15,17-19H2,(H,27,30)/b10-6+ |
| InChIKey | RFJCJLUNCJFTQZ-UXBLZVDNSA-N |
| XLogP | 4.74 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[(5-hydroxy-1,3-dihydroisoindol-2-yl)methyl]-N-[(E)-4-phenylbut-3-enyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-hydroxy-1,3-dihydroisoindol-2-yl)methyl]-N-[(E)-4-phenylbut-3-enyl]benzamide?
The IUPAC name of 2-[(5-hydroxy-1,3-dihydroisoindol-2-yl)methyl]-N-[(E)-4-phenylbut-3-enyl]benzamide (CID 10476003) is 2-[(5-hydroxy-1,3-dihydroisoindol-2-yl)methyl]-N-[(E)-4-phenylbut-3-enyl]benzamide.
What is the SMILES notation for 2-[(5-hydroxy-1,3-dihydroisoindol-2-yl)methyl]-N-[(E)-4-phenylbut-3-enyl]benzamide?
The canonical SMILES for 2-[(5-hydroxy-1,3-dihydroisoindol-2-yl)methyl]-N-[(E)-4-phenylbut-3-enyl]benzamide is O=C(NCC/C=C/c1ccccc1)c1ccccc1CN1Cc2ccc(O)cc2C1.
What is the InChIKey of 2-[(5-hydroxy-1,3-dihydroisoindol-2-yl)methyl]-N-[(E)-4-phenylbut-3-enyl]benzamide?
The InChIKey is RFJCJLUNCJFTQZ-UXBLZVDNSA-N. The full InChI is InChI=1S/C26H26N2O2/c29-24-14-13-21-17-28(19-23(21)16-24)18-22-11-4-5-12-25(22)26(30)27-15-7-6-10-20-8-2-1-3-9-20/h1-6,8-14,16,29H,7,15,17-19H2,(H,27,30)/b10-6+.
What are the key properties of 2-[(5-hydroxy-1,3-dihydroisoindol-2-yl)methyl]-N-[(E)-4-phenylbut-3-enyl]benzamide?
2-[(5-hydroxy-1,3-dihydroisoindol-2-yl)methyl]-N-[(E)-4-phenylbut-3-enyl]benzamide has a molecular weight of 398.51 g/mol, XLogP of 4.74, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-hydroxy-1,3-dihydroisoindol-2-yl)methyl]-N-[(E)-4-phenylbut-3-enyl]benzamide is sourced from PubChem (CID 10476003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).