C13H25NO4S — CID 104760803
N-[(3-methoxyoxolan-3-yl)methyl]-3-methylsulfonylcyclohexan-1-amine (PubChem CID 104760803) has the molecular formula C13H25NO4S and a molecular weight of 291.41 g/mol. Its IUPAC name is N-[(3-methoxyoxolan-3-yl)methyl]-3-methylsulfonylcyclohexan-1-amine.
| Compound Name | N-[(3-methoxyoxolan-3-yl)methyl]-3-methylsulfonylcyclohexan-1-amine |
|---|---|
| PubChem CID | 104760803 |
| Molecular Formula | C13H25NO4S |
| Molecular Weight | 291.41 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | N-[(3-methoxyoxolan-3-yl)methyl]-3-methylsulfonylcyclohexan-1-amine |
| SMILES | COC1(CNC2CCCC(S(C)(=O)=O)C2)CCOC1 |
| InChI | InChI=1S/C13H25NO4S/c1-17-13(6-7-18-10-13)9-14-11-4-3-5-12(8-11)19(2,15)16/h11-12,14H,3-10H2,1-2H3 |
| InChIKey | FPPDWSWMDJHIQF-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.41 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |