C24H36N2O3 — CID 10476129
(10S,13S)-5-hexyl-13-[(1S)-1-hydroxyethyl]-9-methyl-10-propan-2-yl-3-oxa-9,12-diazatricyclo[6.6.1.04,15]pentadeca-1,4,6,8(15)-tetraen-11-one (PubChem CID 10476129) has the molecular formula C24H36N2O3 and a molecular weight of 400.56 g/mol. Its IUPAC name is (10S,13S)-5-hexyl-13-[(1S)-1-hydroxyethyl]-9-methyl-10-propan-2-yl-3-oxa-9,12-diazatricyclo[6.6.1.04,15]pentadeca-1,4,6,8(15)-tetraen-11-one.
| Compound Name | (10S,13S)-5-hexyl-13-[(1S)-1-hydroxyethyl]-9-methyl-10-propan-2-yl-3-oxa-9,12-diazatricyclo[6.6.1.04,15]pentadeca-1,4,6,8(15)-tetraen-11-one |
|---|---|
| PubChem CID | 10476129 |
| Molecular Formula | C24H36N2O3 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.27 |
| IUPAC Name | (10S,13S)-5-hexyl-13-[(1S)-1-hydroxyethyl]-9-methyl-10-propan-2-yl-3-oxa-9,12-diazatricyclo[6.6.1.04,15]pentadeca-1,4,6,8(15)-tetraen-11-one |
| SMILES | CCCCCCc1ccc2c3c(coc13)C[C@@H]([C@H](C)O)NC(=O)[C@H](C(C)C)N2C |
| InChI | InChI=1S/C24H36N2O3/c1-6-7-8-9-10-17-11-12-20-21-18(14-29-23(17)21)13-19(16(4)27)25-24(28)22(15(2)3)26(20)5/h11-12,14-16,19,22,27H,6-10,13H2,1-5H3,(H,25,28)/t16-,19-,22-/m0/s1 |
| InChIKey | UCFDLQKAGHRYLF-BPXKWBHBSA-N |
| XLogP | 4.44 |
| TPSA | 65.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|