C11H24N2O2 — CID 104761328
2-(ethylamino)-N-(2-methoxy-2-methylpropyl)-2-methylpropanamide (PubChem CID 104761328) has the molecular formula C11H24N2O2 and a molecular weight of 216.32 g/mol. Its IUPAC name is 2-(ethylamino)-N-(2-methoxy-2-methylpropyl)-2-methylpropanamide.
| Compound Name | 2-(ethylamino)-N-(2-methoxy-2-methylpropyl)-2-methylpropanamide |
|---|---|
| PubChem CID | 104761328 |
| Molecular Formula | C11H24N2O2 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | 2-(ethylamino)-N-(2-methoxy-2-methylpropyl)-2-methylpropanamide |
| SMILES | CCNC(C)(C)C(=O)NCC(C)(C)OC |
| InChI | InChI=1S/C11H24N2O2/c1-7-13-11(4,5)9(14)12-8-10(2,3)15-6/h13H,7-8H2,1-6H3,(H,12,14) |
| InChIKey | MHELAULNDGBPQT-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |