C13H15N3O4 — CID 104762129
1-[(3-methoxyoxolan-3-yl)methyl]benzotriazole-4-carboxylic acid (PubChem CID 104762129) has the molecular formula C13H15N3O4 and a molecular weight of 277.28 g/mol. Its IUPAC name is 1-[(3-methoxyoxolan-3-yl)methyl]benzotriazole-4-carboxylic acid.
| Compound Name | 1-[(3-methoxyoxolan-3-yl)methyl]benzotriazole-4-carboxylic acid |
|---|---|
| PubChem CID | 104762129 |
| Molecular Formula | C13H15N3O4 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 1-[(3-methoxyoxolan-3-yl)methyl]benzotriazole-4-carboxylic acid |
| SMILES | COC1(Cn2nnc3c(C(=O)O)cccc32)CCOC1 |
| InChI | InChI=1S/C13H15N3O4/c1-19-13(5-6-20-8-13)7-16-10-4-2-3-9(12(17)18)11(10)14-15-16/h2-4H,5-8H2,1H3,(H,17,18) |
| InChIKey | NEPIUILOAYZLSG-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |