C24H36O5 — CID 10476355
[(1R,3aR,4E,6R,9E,12S,12aS)-1-(2-acetyloxypropan-2-yl)-3a,6,10-trimethyl-8-oxo-1,2,3,6,7,11,12,12a-octahydrocyclopenta[11]annulen-12-yl] acetate (PubChem CID 10476355) has the molecular formula C24H36O5 and a molecular weight of 404.55 g/mol. Its IUPAC name is [(1R,3aR,4E,6R,9E,12S,12aS)-1-(2-acetyloxypropan-2-yl)-3a,6,10-trimethyl-8-oxo-1,2,3,6,7,11,12,12a-octahydrocyclopenta[11]annulen-12-yl] acetate.
| Compound Name | [(1R,3aR,4E,6R,9E,12S,12aS)-1-(2-acetyloxypropan-2-yl)-3a,6,10-trimethyl-8-oxo-1,2,3,6,7,11,12,12a-octahydrocyclopenta[11]annulen-12-yl] acetate |
|---|---|
| PubChem CID | 10476355 |
| Molecular Formula | C24H36O5 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.26 |
| IUPAC Name | [(1R,3aR,4E,6R,9E,12S,12aS)-1-(2-acetyloxypropan-2-yl)-3a,6,10-trimethyl-8-oxo-1,2,3,6,7,11,12,12a-octahydrocyclopenta[11]annulen-12-yl] acetate |
| SMILES | CC(=O)O[C@H]1C/C(C)=C/C(=O)C[C@@H](C)/C=C/[C@@]2(C)CC[C@@H](C(C)(C)OC(C)=O)[C@H]12 |
| InChI | InChI=1S/C24H36O5/c1-15-8-10-24(7)11-9-20(23(5,6)29-18(4)26)22(24)21(28-17(3)25)14-16(2)13-19(27)12-15/h8,10,13,15,20-22H,9,11-12,14H2,1-7H3/b10-8+,16-13+/t15-,20+,21-,22+,24-/m0/s1 |
| InChIKey | OILXFXJGVWFWDN-PDSQJYMMSA-N |
| XLogP | 4.79 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|