C26H44OS — CID 10476363
(E)-4-methyl-5-[(2E,6E,10E)-2,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]sulfanylpent-4-en-1-ol (PubChem CID 10476363) has the molecular formula C26H44OS and a molecular weight of 404.70 g/mol. Its IUPAC name is (E)-4-methyl-5-[(2E,6E,10E)-2,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]sulfanylpent-4-en-1-ol.
| Compound Name | (E)-4-methyl-5-[(2E,6E,10E)-2,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]sulfanylpent-4-en-1-ol |
|---|---|
| PubChem CID | 10476363 |
| Molecular Formula | C26H44OS |
| Molecular Weight | 404.70 g/mol |
| Exact Mass | 404.31 |
| IUPAC Name | (E)-4-methyl-5-[(2E,6E,10E)-2,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]sulfanylpent-4-en-1-ol |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C=C(\C)CS/C=C(\C)CCCO |
| InChI | InChI=1S/C26H44OS/c1-22(2)12-9-15-24(4)17-10-16-23(3)13-7-8-14-25(5)20-28-21-26(6)18-11-19-27/h12-14,17,21,27H,7-11,15-16,18-20H2,1-6H3/b23-13+,24-17+,25-14+,26-21+ |
| InChIKey | GOEHJSVIJXIFEM-YCJVSPRJSA-N |
| XLogP | 8.54 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.70 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|