C11H16N2O — CID 104764634
N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]pent-3-yn-1-amine (PubChem CID 104764634) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]pent-3-yn-1-amine.
| Compound Name | N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]pent-3-yn-1-amine |
|---|---|
| PubChem CID | 104764634 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | N-[1-(5-methyl-1,3-oxazol-2-yl)ethyl]pent-3-yn-1-amine |
| SMILES | CC#CCCNC(C)c1ncc(C)o1 |
| InChI | InChI=1S/C11H16N2O/c1-4-5-6-7-12-10(3)11-13-8-9(2)14-11/h8,10,12H,6-7H2,1-3H3 |
| InChIKey | SISPQDDXVSOBRH-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|