C19H19F6NO2 — CID 10476467
N-[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)naphthalen-1-yl]-4-methylpentanamide (PubChem CID 10476467) has the molecular formula C19H19F6NO2 and a molecular weight of 407.35 g/mol. Its IUPAC name is N-[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)naphthalen-1-yl]-4-methylpentanamide.
| Compound Name | N-[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)naphthalen-1-yl]-4-methylpentanamide |
|---|---|
| PubChem CID | 10476467 |
| Molecular Formula | C19H19F6NO2 |
| Molecular Weight | 407.35 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | N-[2-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)naphthalen-1-yl]-4-methylpentanamide |
| SMILES | CC(C)CCC(=O)Nc1c(C(O)(C(F)(F)F)C(F)(F)F)ccc2ccccc12 |
| InChI | InChI=1S/C19H19F6NO2/c1-11(2)7-10-15(27)26-16-13-6-4-3-5-12(13)8-9-14(16)17(28,18(20,21)22)19(23,24)25/h3-6,8-9,11,28H,7,10H2,1-2H3,(H,26,27) |
| InChIKey | RZELQLWNPGHRCA-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.35 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |