C15H18N2O4 — CID 104764916
3-(3-hydroxyprop-1-ynyl)-N-[(3-methoxyoxolan-3-yl)methyl]pyridine-4-carboxamide (PubChem CID 104764916) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is 3-(3-hydroxyprop-1-ynyl)-N-[(3-methoxyoxolan-3-yl)methyl]pyridine-4-carboxamide.
| Compound Name | 3-(3-hydroxyprop-1-ynyl)-N-[(3-methoxyoxolan-3-yl)methyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 104764916 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 3-(3-hydroxyprop-1-ynyl)-N-[(3-methoxyoxolan-3-yl)methyl]pyridine-4-carboxamide |
| SMILES | COC1(CNC(=O)c2ccncc2C#CCO)CCOC1 |
| InChI | InChI=1S/C15H18N2O4/c1-20-15(5-8-21-11-15)10-17-14(19)13-4-6-16-9-12(13)3-2-7-18/h4,6,9,18H,5,7-8,10-11H2,1H3,(H,17,19) |
| InChIKey | FXNUKVDEWYYYEY-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|