C11H22N2O2 — CID 104766089
N'-[(3-methoxyoxolan-3-yl)methyl]-2,2-dimethylpropanimidamide (PubChem CID 104766089) has the molecular formula C11H22N2O2 and a molecular weight of 214.31 g/mol. Its IUPAC name is N'-[(3-methoxyoxolan-3-yl)methyl]-2,2-dimethylpropanimidamide.
| Compound Name | N'-[(3-methoxyoxolan-3-yl)methyl]-2,2-dimethylpropanimidamide |
|---|---|
| PubChem CID | 104766089 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | N'-[(3-methoxyoxolan-3-yl)methyl]-2,2-dimethylpropanimidamide |
| SMILES | COC1(C/N=C(\N)C(C)(C)C)CCOC1 |
| InChI | InChI=1S/C11H22N2O2/c1-10(2,3)9(12)13-7-11(14-4)5-6-15-8-11/h5-8H2,1-4H3,(H2,12,13) |
| InChIKey | WTADXZWAQMPNSF-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|