About 2-[4-(2,3-diphenylpropanoyl)piperazin-1-yl]-2-pyridin-3-ylacetonitrile
2-[4-(2,3-diphenylpropanoyl)piperazin-1-yl]-2-pyridin-3-ylacetonitrile (PubChem CID 10476687) has the molecular formula C26H26N4O
and a molecular weight of 410.52 g/mol. Its IUPAC name is 2-[4-(2,3-diphenylpropanoyl)piperazin-1-yl]-2-pyridin-3-ylacetonitrile.
Molecular Properties
| Compound Name | 2-[4-(2,3-diphenylpropanoyl)piperazin-1-yl]-2-pyridin-3-ylacetonitrile |
| PubChem CID | 10476687 |
| Molecular Formula | C26H26N4O |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 2-[4-(2,3-diphenylpropanoyl)piperazin-1-yl]-2-pyridin-3-ylacetonitrile |
| SMILES | N#CC(c1cccnc1)N1CCN(C(=O)C(Cc2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C26H26N4O/c27-19-25(23-12-7-13-28-20-23)29-14-16-30(17-15-29)26(31)24(22-10-5-2-6-11-22)18-21-8-3-1-4-9-21/h1-13,20,24-25H,14-18H2 |
| InChIKey | JOGXXWAQGKTITB-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 60.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[4-(2,3-diphenylpropanoyl)piperazin-1-yl]-2-pyridin-3-ylacetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(2,3-diphenylpropanoyl)piperazin-1-yl]-2-pyridin-3-ylacetonitrile?
The IUPAC name of 2-[4-(2,3-diphenylpropanoyl)piperazin-1-yl]-2-pyridin-3-ylacetonitrile (CID 10476687) is 2-[4-(2,3-diphenylpropanoyl)piperazin-1-yl]-2-pyridin-3-ylacetonitrile.
What is the SMILES notation for 2-[4-(2,3-diphenylpropanoyl)piperazin-1-yl]-2-pyridin-3-ylacetonitrile?
The canonical SMILES for 2-[4-(2,3-diphenylpropanoyl)piperazin-1-yl]-2-pyridin-3-ylacetonitrile is N#CC(c1cccnc1)N1CCN(C(=O)C(Cc2ccccc2)c2ccccc2)CC1.
What is the InChIKey of 2-[4-(2,3-diphenylpropanoyl)piperazin-1-yl]-2-pyridin-3-ylacetonitrile?
The InChIKey is JOGXXWAQGKTITB-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H26N4O/c27-19-25(23-12-7-13-28-20-23)29-14-16-30(17-15-29)26(31)24(22-10-5-2-6-11-22)18-21-8-3-1-4-9-21/h1-13,20,24-25H,14-18H2.
What are the key properties of 2-[4-(2,3-diphenylpropanoyl)piperazin-1-yl]-2-pyridin-3-ylacetonitrile?
2-[4-(2,3-diphenylpropanoyl)piperazin-1-yl]-2-pyridin-3-ylacetonitrile has a molecular weight of 410.52 g/mol, XLogP of 3.82, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2,3-diphenylpropanoyl)piperazin-1-yl]-2-pyridin-3-ylacetonitrile is sourced from PubChem (CID 10476687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).