C10H16ClN5O2 — CID 104767567
5-chloro-2-hydrazinyl-N-[(3-methoxyoxolan-3-yl)methyl]pyrimidin-4-amine (PubChem CID 104767567) has the molecular formula C10H16ClN5O2 and a molecular weight of 273.72 g/mol. Its IUPAC name is 5-chloro-2-hydrazinyl-N-[(3-methoxyoxolan-3-yl)methyl]pyrimidin-4-amine.
| Compound Name | 5-chloro-2-hydrazinyl-N-[(3-methoxyoxolan-3-yl)methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 104767567 |
| Molecular Formula | C10H16ClN5O2 |
| Molecular Weight | 273.72 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 5-chloro-2-hydrazinyl-N-[(3-methoxyoxolan-3-yl)methyl]pyrimidin-4-amine |
| SMILES | COC1(CNc2nc(NN)ncc2Cl)CCOC1 |
| InChI | InChI=1S/C10H16ClN5O2/c1-17-10(2-3-18-6-10)5-14-8-7(11)4-13-9(15-8)16-12/h4H,2-3,5-6,12H2,1H3,(H2,13,14,15,16) |
| InChIKey | RAVRIHOFMIJQCM-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.72 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|