About 4-[[4-(bromomethyl)-2-chlorophenoxy]methyl]-3,4-dihydro-2H-chromene
4-[[4-(bromomethyl)-2-chlorophenoxy]methyl]-3,4-dihydro-2H-chromene (PubChem CID 104768788) has the molecular formula C17H16BrClO2
and a molecular weight of 367.67 g/mol. Its IUPAC name is 4-[[4-(bromomethyl)-2-chlorophenoxy]methyl]-3,4-dihydro-2H-chromene.
Molecular Properties
| Compound Name | 4-[[4-(bromomethyl)-2-chlorophenoxy]methyl]-3,4-dihydro-2H-chromene |
| PubChem CID | 104768788 |
| Molecular Formula | C17H16BrClO2 |
| Molecular Weight | 367.67 g/mol |
| Exact Mass | 366.00 |
| IUPAC Name | 4-[[4-(bromomethyl)-2-chlorophenoxy]methyl]-3,4-dihydro-2H-chromene |
| SMILES | Clc1cc(CBr)ccc1OCC1CCOc2ccccc21 |
| InChI | InChI=1S/C17H16BrClO2/c18-10-12-5-6-17(15(19)9-12)21-11-13-7-8-20-16-4-2-1-3-14(13)16/h1-6,9,13H,7-8,10-11H2 |
| InChIKey | AFGCAUBFIXZALU-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 367.67 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-[[4-(bromomethyl)-2-chlorophenoxy]methyl]-3,4-dihydro-2H-chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[4-(bromomethyl)-2-chlorophenoxy]methyl]-3,4-dihydro-2H-chromene?
The IUPAC name of 4-[[4-(bromomethyl)-2-chlorophenoxy]methyl]-3,4-dihydro-2H-chromene (CID 104768788) is 4-[[4-(bromomethyl)-2-chlorophenoxy]methyl]-3,4-dihydro-2H-chromene.
What is the SMILES notation for 4-[[4-(bromomethyl)-2-chlorophenoxy]methyl]-3,4-dihydro-2H-chromene?
The canonical SMILES for 4-[[4-(bromomethyl)-2-chlorophenoxy]methyl]-3,4-dihydro-2H-chromene is Clc1cc(CBr)ccc1OCC1CCOc2ccccc21.
What is the InChIKey of 4-[[4-(bromomethyl)-2-chlorophenoxy]methyl]-3,4-dihydro-2H-chromene?
The InChIKey is AFGCAUBFIXZALU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16BrClO2/c18-10-12-5-6-17(15(19)9-12)21-11-13-7-8-20-16-4-2-1-3-14(13)16/h1-6,9,13H,7-8,10-11H2.
What are the key properties of 4-[[4-(bromomethyl)-2-chlorophenoxy]methyl]-3,4-dihydro-2H-chromene?
4-[[4-(bromomethyl)-2-chlorophenoxy]methyl]-3,4-dihydro-2H-chromene has a molecular weight of 367.67 g/mol, XLogP of 5.18, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[4-(bromomethyl)-2-chlorophenoxy]methyl]-3,4-dihydro-2H-chromene is sourced from PubChem (CID 104768788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).