C13H17NO3 — CID 104768885
3-(3,4-dihydro-2H-chromen-4-ylmethylamino)propanoic acid (PubChem CID 104768885) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-chromen-4-ylmethylamino)propanoic acid.
| Compound Name | 3-(3,4-dihydro-2H-chromen-4-ylmethylamino)propanoic acid |
|---|---|
| PubChem CID | 104768885 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 3-(3,4-dihydro-2H-chromen-4-ylmethylamino)propanoic acid |
| SMILES | O=C(O)CCNCC1CCOc2ccccc21 |
| InChI | InChI=1S/C13H17NO3/c15-13(16)5-7-14-9-10-6-8-17-12-4-2-1-3-11(10)12/h1-4,10,14H,5-9H2,(H,15,16) |
| InChIKey | XCXMKFABLOOHRB-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|