C15H20O2 — CID 104769879
1-(3,4-dihydro-2H-chromen-4-yl)hexan-2-one (PubChem CID 104769879) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-4-yl)hexan-2-one.
| Compound Name | 1-(3,4-dihydro-2H-chromen-4-yl)hexan-2-one |
|---|---|
| PubChem CID | 104769879 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-4-yl)hexan-2-one |
| SMILES | CCCCC(=O)CC1CCOc2ccccc21 |
| InChI | InChI=1S/C15H20O2/c1-2-3-6-13(16)11-12-9-10-17-15-8-5-4-7-14(12)15/h4-5,7-8,12H,2-3,6,9-11H2,1H3 |
| InChIKey | IBNMUCLTDRQSBI-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |