C23H20N4O4 — CID 10476997
5-cyano-2-[[7-(cyclopentanecarbonylamino)-1H-indole-2-carbonyl]amino]benzoic acid (PubChem CID 10476997) has the molecular formula C23H20N4O4 and a molecular weight of 416.44 g/mol. Its IUPAC name is 5-cyano-2-[[7-(cyclopentanecarbonylamino)-1H-indole-2-carbonyl]amino]benzoic acid.
| Compound Name | 5-cyano-2-[[7-(cyclopentanecarbonylamino)-1H-indole-2-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 10476997 |
| Molecular Formula | C23H20N4O4 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 5-cyano-2-[[7-(cyclopentanecarbonylamino)-1H-indole-2-carbonyl]amino]benzoic acid |
| SMILES | N#Cc1ccc(NC(=O)c2cc3cccc(NC(=O)C4CCCC4)c3[nH]2)c(C(=O)O)c1 |
| InChI | InChI=1S/C23H20N4O4/c24-12-13-8-9-17(16(10-13)23(30)31)26-22(29)19-11-15-6-3-7-18(20(15)25-19)27-21(28)14-4-1-2-5-14/h3,6-11,14,25H,1-2,4-5H2,(H,26,29)(H,27,28)(H,30,31) |
| InChIKey | LYCYISNFJNJOAU-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 135.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |