C18H20ClNO — CID 104770108
1-(3-chlorophenyl)-3-(3,4-dihydro-2H-chromen-4-yl)propan-2-amine (PubChem CID 104770108) has the molecular formula C18H20ClNO and a molecular weight of 301.82 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-(3,4-dihydro-2H-chromen-4-yl)propan-2-amine.
| Compound Name | 1-(3-chlorophenyl)-3-(3,4-dihydro-2H-chromen-4-yl)propan-2-amine |
|---|---|
| PubChem CID | 104770108 |
| Molecular Formula | C18H20ClNO |
| Molecular Weight | 301.82 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 1-(3-chlorophenyl)-3-(3,4-dihydro-2H-chromen-4-yl)propan-2-amine |
| SMILES | NC(Cc1cccc(Cl)c1)CC1CCOc2ccccc21 |
| InChI | InChI=1S/C18H20ClNO/c19-15-5-3-4-13(10-15)11-16(20)12-14-8-9-21-18-7-2-1-6-17(14)18/h1-7,10,14,16H,8-9,11-12,20H2 |
| InChIKey | UJPPLFQCILUERX-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.82 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |