C21H21F6NO — CID 10477054
(2S,3S)-3-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-phenylpiperidine (PubChem CID 10477054) has the molecular formula C21H21F6NO and a molecular weight of 417.39 g/mol. Its IUPAC name is (2S,3S)-3-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-phenylpiperidine.
| Compound Name | (2S,3S)-3-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-phenylpiperidine |
|---|---|
| PubChem CID | 10477054 |
| Molecular Formula | C21H21F6NO |
| Molecular Weight | 417.39 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | (2S,3S)-3-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-phenylpiperidine |
| SMILES | C[C@@H](O[C@H]1CCCNC1c1ccccc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H21F6NO/c1-13(15-10-16(20(22,23)24)12-17(11-15)21(25,26)27)29-18-8-5-9-28-19(18)14-6-3-2-4-7-14/h2-4,6-7,10-13,18-19,28H,5,8-9H2,1H3/t13-,18+,19?/m1/s1 |
| InChIKey | AXRHJNPWSRJZKN-OJBAKJFDSA-N |
| XLogP | 6.30 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.39 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |