About N-methyl-2-(4-methyl-1,3-thiazol-2-yl)pyrimidin-4-amine
N-methyl-2-(4-methyl-1,3-thiazol-2-yl)pyrimidin-4-amine (PubChem CID 104771354) has the molecular formula C9H10N4S
and a molecular weight of 206.27 g/mol. Its IUPAC name is N-methyl-2-(4-methyl-1,3-thiazol-2-yl)pyrimidin-4-amine.
Molecular Properties
| Compound Name | N-methyl-2-(4-methyl-1,3-thiazol-2-yl)pyrimidin-4-amine |
| PubChem CID | 104771354 |
| Molecular Formula | C9H10N4S |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | N-methyl-2-(4-methyl-1,3-thiazol-2-yl)pyrimidin-4-amine |
| SMILES | CNc1ccnc(-c2nc(C)cs2)n1 |
| InChI | InChI=1S/C9H10N4S/c1-6-5-14-9(12-6)8-11-4-3-7(10-2)13-8/h3-5H,1-2H3,(H,10,11,13) |
| InChIKey | NYVWTEYFAPSTBR-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-methyl-2-(4-methyl-1,3-thiazol-2-yl)pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-2-(4-methyl-1,3-thiazol-2-yl)pyrimidin-4-amine?
The IUPAC name of N-methyl-2-(4-methyl-1,3-thiazol-2-yl)pyrimidin-4-amine (CID 104771354) is N-methyl-2-(4-methyl-1,3-thiazol-2-yl)pyrimidin-4-amine.
What is the SMILES notation for N-methyl-2-(4-methyl-1,3-thiazol-2-yl)pyrimidin-4-amine?
The canonical SMILES for N-methyl-2-(4-methyl-1,3-thiazol-2-yl)pyrimidin-4-amine is CNc1ccnc(-c2nc(C)cs2)n1.
What is the InChIKey of N-methyl-2-(4-methyl-1,3-thiazol-2-yl)pyrimidin-4-amine?
The InChIKey is NYVWTEYFAPSTBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4S/c1-6-5-14-9(12-6)8-11-4-3-7(10-2)13-8/h3-5H,1-2H3,(H,10,11,13).
What are the key properties of N-methyl-2-(4-methyl-1,3-thiazol-2-yl)pyrimidin-4-amine?
N-methyl-2-(4-methyl-1,3-thiazol-2-yl)pyrimidin-4-amine has a molecular weight of 206.27 g/mol, XLogP of 1.95, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-2-(4-methyl-1,3-thiazol-2-yl)pyrimidin-4-amine is sourced from PubChem (CID 104771354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).