About 5-[(5-methylimidazo[1,2-a]pyridin-1-ium-1-yl)methyl]-3,3-diphenyloxolan-2-one chloride
5-[(5-methylimidazo[1,2-a]pyridin-1-ium-1-yl)methyl]-3,3-diphenyloxolan-2-one chloride (PubChem CID 10477149) has the molecular formula C25H23ClN2O2
and a molecular weight of 418.92 g/mol. Its IUPAC name is 5-[(5-methylimidazo[1,2-a]pyridin-1-ium-1-yl)methyl]-3,3-diphenyloxolan-2-one chloride.
Molecular Properties
| Compound Name | 5-[(5-methylimidazo[1,2-a]pyridin-1-ium-1-yl)methyl]-3,3-diphenyloxolan-2-one chloride |
| PubChem CID | 10477149 |
| Molecular Formula | C25H23ClN2O2 |
| Molecular Weight | 418.92 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | 5-[(5-methylimidazo[1,2-a]pyridin-1-ium-1-yl)methyl]-3,3-diphenyloxolan-2-one chloride |
| SMILES | Cc1cccc2n1cc[n+]2CC1CC(c2ccccc2)(c2ccccc2)C(=O)O1.[Cl-] |
| InChI | InChI=1S/C25H23N2O2.ClH/c1-19-9-8-14-23-26(15-16-27(19)23)18-22-17-25(24(28)29-22,20-10-4-2-5-11-20)21-12-6-3-7-13-21;/h2-16,22H,17-18H2,1H3;1H/q+1;/p-1 |
| InChIKey | ZPZZKZABMZYTLH-UHFFFAOYSA-M |
| XLogP | 0.84 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.92 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 5-[(5-methylimidazo[1,2-a]pyridin-1-ium-1-yl)methyl]-3,3-diphenyloxolan-2-one chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(5-methylimidazo[1,2-a]pyridin-1-ium-1-yl)methyl]-3,3-diphenyloxolan-2-one chloride?
The IUPAC name of 5-[(5-methylimidazo[1,2-a]pyridin-1-ium-1-yl)methyl]-3,3-diphenyloxolan-2-one chloride (CID 10477149) is 5-[(5-methylimidazo[1,2-a]pyridin-1-ium-1-yl)methyl]-3,3-diphenyloxolan-2-one chloride.
What is the SMILES notation for 5-[(5-methylimidazo[1,2-a]pyridin-1-ium-1-yl)methyl]-3,3-diphenyloxolan-2-one chloride?
The canonical SMILES for 5-[(5-methylimidazo[1,2-a]pyridin-1-ium-1-yl)methyl]-3,3-diphenyloxolan-2-one chloride is Cc1cccc2n1cc[n+]2CC1CC(c2ccccc2)(c2ccccc2)C(=O)O1.[Cl-].
What is the InChIKey of 5-[(5-methylimidazo[1,2-a]pyridin-1-ium-1-yl)methyl]-3,3-diphenyloxolan-2-one chloride?
The InChIKey is ZPZZKZABMZYTLH-UHFFFAOYSA-M. The full InChI is InChI=1S/C25H23N2O2.ClH/c1-19-9-8-14-23-26(15-16-27(19)23)18-22-17-25(24(28)29-22,20-10-4-2-5-11-20)21-12-6-3-7-13-21;/h2-16,22H,17-18H2,1H3;1H/q+1;/p-1.
What are the key properties of 5-[(5-methylimidazo[1,2-a]pyridin-1-ium-1-yl)methyl]-3,3-diphenyloxolan-2-one chloride?
5-[(5-methylimidazo[1,2-a]pyridin-1-ium-1-yl)methyl]-3,3-diphenyloxolan-2-one chloride has a molecular weight of 418.92 g/mol, XLogP of 0.84, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(5-methylimidazo[1,2-a]pyridin-1-ium-1-yl)methyl]-3,3-diphenyloxolan-2-one chloride is sourced from PubChem (CID 10477149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).