C22H24F3N3O2 — CID 10477164
(2S,5R)-5-ethynyl-1-[2-[[4-[4-(trifluoromethyl)phenoxy]cyclohexyl]amino]acetyl]pyrrolidine-2-carbonitrile (PubChem CID 10477164) has the molecular formula C22H24F3N3O2 and a molecular weight of 419.45 g/mol. Its IUPAC name is (2S,5R)-5-ethynyl-1-[2-[[4-[4-(trifluoromethyl)phenoxy]cyclohexyl]amino]acetyl]pyrrolidine-2-carbonitrile.
| Compound Name | (2S,5R)-5-ethynyl-1-[2-[[4-[4-(trifluoromethyl)phenoxy]cyclohexyl]amino]acetyl]pyrrolidine-2-carbonitrile |
|---|---|
| PubChem CID | 10477164 |
| Molecular Formula | C22H24F3N3O2 |
| Molecular Weight | 419.45 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | (2S,5R)-5-ethynyl-1-[2-[[4-[4-(trifluoromethyl)phenoxy]cyclohexyl]amino]acetyl]pyrrolidine-2-carbonitrile |
| SMILES | C#C[C@H]1CC[C@@H](C#N)N1C(=O)CNC1CCC(Oc2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C22H24F3N3O2/c1-2-17-7-8-18(13-26)28(17)21(29)14-27-16-5-11-20(12-6-16)30-19-9-3-15(4-10-19)22(23,24)25/h1,3-4,9-10,16-18,20,27H,5-8,11-12,14H2/t16?,17-,18-,20?/m0/s1 |
| InChIKey | NLZWIGAGQGHOJT-NRGCRIOASA-N |
| XLogP | 3.50 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.45 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|