About methyl 5-[2-(trifluoromethylsulfanyl)ethylsulfamoyl]-1,3-thiazole-4-carboxylate
methyl 5-[2-(trifluoromethylsulfanyl)ethylsulfamoyl]-1,3-thiazole-4-carboxylate (PubChem CID 104772953) has the molecular formula C8H9F3N2O4S3
and a molecular weight of 350.37 g/mol. Its IUPAC name is methyl 5-[2-(trifluoromethylsulfanyl)ethylsulfamoyl]-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 5-[2-(trifluoromethylsulfanyl)ethylsulfamoyl]-1,3-thiazole-4-carboxylate |
| PubChem CID | 104772953 |
| Molecular Formula | C8H9F3N2O4S3 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 349.97 |
| IUPAC Name | methyl 5-[2-(trifluoromethylsulfanyl)ethylsulfamoyl]-1,3-thiazole-4-carboxylate |
| SMILES | COC(=O)c1ncsc1S(=O)(=O)NCCSC(F)(F)F |
| InChI | InChI=1S/C8H9F3N2O4S3/c1-17-6(14)5-7(18-4-12-5)20(15,16)13-2-3-19-8(9,10)11/h4,13H,2-3H2,1H3 |
| InChIKey | URKWQZJTEWAAAR-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-[2-(trifluoromethylsulfanyl)ethylsulfamoyl]-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[2-(trifluoromethylsulfanyl)ethylsulfamoyl]-1,3-thiazole-4-carboxylate?
The IUPAC name of methyl 5-[2-(trifluoromethylsulfanyl)ethylsulfamoyl]-1,3-thiazole-4-carboxylate (CID 104772953) is methyl 5-[2-(trifluoromethylsulfanyl)ethylsulfamoyl]-1,3-thiazole-4-carboxylate.
What is the SMILES notation for methyl 5-[2-(trifluoromethylsulfanyl)ethylsulfamoyl]-1,3-thiazole-4-carboxylate?
The canonical SMILES for methyl 5-[2-(trifluoromethylsulfanyl)ethylsulfamoyl]-1,3-thiazole-4-carboxylate is COC(=O)c1ncsc1S(=O)(=O)NCCSC(F)(F)F.
What is the InChIKey of methyl 5-[2-(trifluoromethylsulfanyl)ethylsulfamoyl]-1,3-thiazole-4-carboxylate?
The InChIKey is URKWQZJTEWAAAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F3N2O4S3/c1-17-6(14)5-7(18-4-12-5)20(15,16)13-2-3-19-8(9,10)11/h4,13H,2-3H2,1H3.
What are the key properties of methyl 5-[2-(trifluoromethylsulfanyl)ethylsulfamoyl]-1,3-thiazole-4-carboxylate?
methyl 5-[2-(trifluoromethylsulfanyl)ethylsulfamoyl]-1,3-thiazole-4-carboxylate has a molecular weight of 350.37 g/mol, XLogP of 1.46, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[2-(trifluoromethylsulfanyl)ethylsulfamoyl]-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 104772953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).