C14H22N2O2S — CID 104773741
N-ethyl-N-propan-2-yl-1,2,3,4-tetrahydroquinoline-5-sulfonamide (PubChem CID 104773741) has the molecular formula C14H22N2O2S and a molecular weight of 282.41 g/mol. Its IUPAC name is N-ethyl-N-propan-2-yl-1,2,3,4-tetrahydroquinoline-5-sulfonamide.
| Compound Name | N-ethyl-N-propan-2-yl-1,2,3,4-tetrahydroquinoline-5-sulfonamide |
|---|---|
| PubChem CID | 104773741 |
| Molecular Formula | C14H22N2O2S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | N-ethyl-N-propan-2-yl-1,2,3,4-tetrahydroquinoline-5-sulfonamide |
| SMILES | CCN(C(C)C)S(=O)(=O)c1cccc2c1CCCN2 |
| InChI | InChI=1S/C14H22N2O2S/c1-4-16(11(2)3)19(17,18)14-9-5-8-13-12(14)7-6-10-15-13/h5,8-9,11,15H,4,6-7,10H2,1-3H3 |
| InChIKey | ZBJWJDVAQBOMIQ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |