About N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)quinoline-5-sulfonamide
N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)quinoline-5-sulfonamide (PubChem CID 104774035) has the molecular formula C13H13N5O2S
and a molecular weight of 303.35 g/mol. Its IUPAC name is N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)quinoline-5-sulfonamide.
Molecular Properties
| Compound Name | N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)quinoline-5-sulfonamide |
| PubChem CID | 104774035 |
| Molecular Formula | C13H13N5O2S |
| Molecular Weight | 303.35 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)quinoline-5-sulfonamide |
| SMILES | CN(Cc1ncn[nH]1)S(=O)(=O)c1cccc2ncccc12 |
| InChI | InChI=1S/C13H13N5O2S/c1-18(8-13-15-9-16-17-13)21(19,20)12-6-2-5-11-10(12)4-3-7-14-11/h2-7,9H,8H2,1H3,(H,15,16,17) |
| InChIKey | WIWAVDDYYWMFNK-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.35 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)quinoline-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)quinoline-5-sulfonamide?
The IUPAC name of N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)quinoline-5-sulfonamide (CID 104774035) is N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)quinoline-5-sulfonamide.
What is the SMILES notation for N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)quinoline-5-sulfonamide?
The canonical SMILES for N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)quinoline-5-sulfonamide is CN(Cc1ncn[nH]1)S(=O)(=O)c1cccc2ncccc12.
What is the InChIKey of N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)quinoline-5-sulfonamide?
The InChIKey is WIWAVDDYYWMFNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N5O2S/c1-18(8-13-15-9-16-17-13)21(19,20)12-6-2-5-11-10(12)4-3-7-14-11/h2-7,9H,8H2,1H3,(H,15,16,17).
What are the key properties of N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)quinoline-5-sulfonamide?
N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)quinoline-5-sulfonamide has a molecular weight of 303.35 g/mol, XLogP of 1.17, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)quinoline-5-sulfonamide is sourced from PubChem (CID 104774035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).