C13H13N5O2S — CID 104774035
N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)quinoline-5-sulfonamide (PubChem CID 104774035) has the molecular formula C13H13N5O2S and a molecular weight of 303.35 g/mol. Its IUPAC name is N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)quinoline-5-sulfonamide.
| Compound Name | N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)quinoline-5-sulfonamide |
|---|---|
| PubChem CID | 104774035 |
| Molecular Formula | C13H13N5O2S |
| Molecular Weight | 303.35 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | N-methyl-N-(1H-1,2,4-triazol-5-ylmethyl)quinoline-5-sulfonamide |
| SMILES | CN(Cc1ncn[nH]1)S(=O)(=O)c1cccc2ncccc12 |
| InChI | InChI=1S/C13H13N5O2S/c1-18(8-13-15-9-16-17-13)21(19,20)12-6-2-5-11-10(12)4-3-7-14-11/h2-7,9H,8H2,1H3,(H,15,16,17) |
| InChIKey | WIWAVDDYYWMFNK-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.35 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |