C14H18N4O2S — CID 104774337
3-[methyl-(8-methylquinolin-5-yl)sulfonylamino]propanimidamide (PubChem CID 104774337) has the molecular formula C14H18N4O2S and a molecular weight of 306.39 g/mol. Its IUPAC name is 3-[methyl-(8-methylquinolin-5-yl)sulfonylamino]propanimidamide.
| Compound Name | 3-[methyl-(8-methylquinolin-5-yl)sulfonylamino]propanimidamide |
|---|---|
| PubChem CID | 104774337 |
| Molecular Formula | C14H18N4O2S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 3-[methyl-(8-methylquinolin-5-yl)sulfonylamino]propanimidamide |
| SMILES | [H]/N=C(\N)CCN(C)S(=O)(=O)c1ccc(C)c2ncccc12 |
| InChI | InChI=1S/C14H18N4O2S/c1-10-5-6-12(11-4-3-8-17-14(10)11)21(19,20)18(2)9-7-13(15)16/h3-6,8H,7,9H2,1-2H3,(H3,15,16) |
| InChIKey | RYZZVVKKGMATGZ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 100.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|