C23H28N4O4 — CID 10477446
3-[[2-[[2,2-dimethyl-1-(1-methylpyrrol-2-yl)propyl]amino]-3,4-dioxocyclobuten-1-yl]amino]-2-hydroxy-N,N-dimethylbenzamide (PubChem CID 10477446) has the molecular formula C23H28N4O4 and a molecular weight of 424.50 g/mol. Its IUPAC name is 3-[[2-[[2,2-dimethyl-1-(1-methylpyrrol-2-yl)propyl]amino]-3,4-dioxocyclobuten-1-yl]amino]-2-hydroxy-N,N-dimethylbenzamide.
| Compound Name | 3-[[2-[[2,2-dimethyl-1-(1-methylpyrrol-2-yl)propyl]amino]-3,4-dioxocyclobuten-1-yl]amino]-2-hydroxy-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 10477446 |
| Molecular Formula | C23H28N4O4 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | 3-[[2-[[2,2-dimethyl-1-(1-methylpyrrol-2-yl)propyl]amino]-3,4-dioxocyclobuten-1-yl]amino]-2-hydroxy-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cccc(Nc2c(NC(c3cccn3C)C(C)(C)C)c(=O)c2=O)c1O |
| InChI | InChI=1S/C23H28N4O4/c1-23(2,3)21(15-11-8-12-27(15)6)25-17-16(19(29)20(17)30)24-14-10-7-9-13(18(14)28)22(31)26(4)5/h7-12,21,24-25,28H,1-6H3 |
| InChIKey | KCLGZMKXIKJPTP-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 103.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|