C13H18BrFN2S — CID 104776279
3-(aminomethyl)-N-(3-bromo-4-fluorophenyl)-2-methylthian-3-amine (PubChem CID 104776279) has the molecular formula C13H18BrFN2S and a molecular weight of 333.27 g/mol. Its IUPAC name is 3-(aminomethyl)-N-(3-bromo-4-fluorophenyl)-2-methylthian-3-amine.
| Compound Name | 3-(aminomethyl)-N-(3-bromo-4-fluorophenyl)-2-methylthian-3-amine |
|---|---|
| PubChem CID | 104776279 |
| Molecular Formula | C13H18BrFN2S |
| Molecular Weight | 333.27 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | 3-(aminomethyl)-N-(3-bromo-4-fluorophenyl)-2-methylthian-3-amine |
| SMILES | CC1SCCCC1(CN)Nc1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C13H18BrFN2S/c1-9-13(8-16,5-2-6-18-9)17-10-3-4-12(15)11(14)7-10/h3-4,7,9,17H,2,5-6,8,16H2,1H3 |
| InChIKey | CWQOOUIBJYTPEC-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.27 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |