C14H19BrFN3 — CID 104776450
3-(aminomethyl)-N-(3-bromo-4-fluorophenyl)-1-azabicyclo[2.2.2]octan-3-amine (PubChem CID 104776450) has the molecular formula C14H19BrFN3 and a molecular weight of 328.23 g/mol. Its IUPAC name is 3-(aminomethyl)-N-(3-bromo-4-fluorophenyl)-1-azabicyclo[2.2.2]octan-3-amine.
| Compound Name | 3-(aminomethyl)-N-(3-bromo-4-fluorophenyl)-1-azabicyclo[2.2.2]octan-3-amine |
|---|---|
| PubChem CID | 104776450 |
| Molecular Formula | C14H19BrFN3 |
| Molecular Weight | 328.23 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | 3-(aminomethyl)-N-(3-bromo-4-fluorophenyl)-1-azabicyclo[2.2.2]octan-3-amine |
| SMILES | NCC1(Nc2ccc(F)c(Br)c2)CN2CCC1CC2 |
| InChI | InChI=1S/C14H19BrFN3/c15-12-7-11(1-2-13(12)16)18-14(8-17)9-19-5-3-10(14)4-6-19/h1-2,7,10,18H,3-6,8-9,17H2 |
| InChIKey | AIOBRKNLHBMIMX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.23 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |