About 3-bromo-N-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-4-fluoroaniline
3-bromo-N-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-4-fluoroaniline (PubChem CID 104777667) has the molecular formula C15H13BrFNS
and a molecular weight of 338.25 g/mol. Its IUPAC name is 3-bromo-N-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-4-fluoroaniline.
Molecular Properties
| Compound Name | 3-bromo-N-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-4-fluoroaniline |
| PubChem CID | 104777667 |
| Molecular Formula | C15H13BrFNS |
| Molecular Weight | 338.25 g/mol |
| Exact Mass | 336.99 |
| IUPAC Name | 3-bromo-N-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-4-fluoroaniline |
| SMILES | Fc1ccc(NCC2Cc3ccccc3S2)cc1Br |
| InChI | InChI=1S/C15H13BrFNS/c16-13-8-11(5-6-14(13)17)18-9-12-7-10-3-1-2-4-15(10)19-12/h1-6,8,12,18H,7,9H2 |
| InChIKey | KLSCEBDSLTZSMU-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.25 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-bromo-N-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-4-fluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-N-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-4-fluoroaniline?
The IUPAC name of 3-bromo-N-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-4-fluoroaniline (CID 104777667) is 3-bromo-N-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-4-fluoroaniline.
What is the SMILES notation for 3-bromo-N-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-4-fluoroaniline?
The canonical SMILES for 3-bromo-N-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-4-fluoroaniline is Fc1ccc(NCC2Cc3ccccc3S2)cc1Br.
What is the InChIKey of 3-bromo-N-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-4-fluoroaniline?
The InChIKey is KLSCEBDSLTZSMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13BrFNS/c16-13-8-11(5-6-14(13)17)18-9-12-7-10-3-1-2-4-15(10)19-12/h1-6,8,12,18H,7,9H2.
What are the key properties of 3-bromo-N-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-4-fluoroaniline?
3-bromo-N-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-4-fluoroaniline has a molecular weight of 338.25 g/mol, XLogP of 4.72, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-N-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-4-fluoroaniline is sourced from PubChem (CID 104777667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).