About (7-benzoyl-2,3-diphenylindolizin-1-yl) acetate
(7-benzoyl-2,3-diphenylindolizin-1-yl) acetate (PubChem CID 10477852) has the molecular formula C29H21NO3
and a molecular weight of 431.49 g/mol. Its IUPAC name is (7-benzoyl-2,3-diphenylindolizin-1-yl) acetate.
Molecular Properties
| Compound Name | (7-benzoyl-2,3-diphenylindolizin-1-yl) acetate |
| PubChem CID | 10477852 |
| Molecular Formula | C29H21NO3 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | (7-benzoyl-2,3-diphenylindolizin-1-yl) acetate |
| SMILES | CC(=O)Oc1c(-c2ccccc2)c(-c2ccccc2)n2ccc(C(=O)c3ccccc3)cc12 |
| InChI | InChI=1S/C29H21NO3/c1-20(31)33-29-25-19-24(28(32)23-15-9-4-10-16-23)17-18-30(25)27(22-13-7-3-8-14-22)26(29)21-11-5-2-6-12-21/h2-19H,1H3 |
| InChIKey | QYJOCZAVTRAJNT-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (7-benzoyl-2,3-diphenylindolizin-1-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-benzoyl-2,3-diphenylindolizin-1-yl) acetate?
The IUPAC name of (7-benzoyl-2,3-diphenylindolizin-1-yl) acetate (CID 10477852) is (7-benzoyl-2,3-diphenylindolizin-1-yl) acetate.
What is the SMILES notation for (7-benzoyl-2,3-diphenylindolizin-1-yl) acetate?
The canonical SMILES for (7-benzoyl-2,3-diphenylindolizin-1-yl) acetate is CC(=O)Oc1c(-c2ccccc2)c(-c2ccccc2)n2ccc(C(=O)c3ccccc3)cc12.
What is the InChIKey of (7-benzoyl-2,3-diphenylindolizin-1-yl) acetate?
The InChIKey is QYJOCZAVTRAJNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H21NO3/c1-20(31)33-29-25-19-24(28(32)23-15-9-4-10-16-23)17-18-30(25)27(22-13-7-3-8-14-22)26(29)21-11-5-2-6-12-21/h2-19H,1H3.
What are the key properties of (7-benzoyl-2,3-diphenylindolizin-1-yl) acetate?
(7-benzoyl-2,3-diphenylindolizin-1-yl) acetate has a molecular weight of 431.49 g/mol, XLogP of 6.43, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (7-benzoyl-2,3-diphenylindolizin-1-yl) acetate is sourced from PubChem (CID 10477852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).