C7Cl2F13NO — CID 10477888
(1Z)-N-(1,3-dichloro-1,1,2,3,3-pentafluoropropan-2-yl)oxy-2,2,3,3,4,4,4-heptafluorobutanimidoyl fluoride (PubChem CID 10477888) has the molecular formula C7Cl2F13NO and a molecular weight of 431.96 g/mol. Its IUPAC name is (1Z)-N-(1,3-dichloro-1,1,2,3,3-pentafluoropropan-2-yl)oxy-2,2,3,3,4,4,4-heptafluorobutanimidoyl fluoride.
| Compound Name | (1Z)-N-(1,3-dichloro-1,1,2,3,3-pentafluoropropan-2-yl)oxy-2,2,3,3,4,4,4-heptafluorobutanimidoyl fluoride |
|---|---|
| PubChem CID | 10477888 |
| Molecular Formula | C7Cl2F13NO |
| Molecular Weight | 431.96 g/mol |
| Exact Mass | 430.91 |
| IUPAC Name | (1Z)-N-(1,3-dichloro-1,1,2,3,3-pentafluoropropan-2-yl)oxy-2,2,3,3,4,4,4-heptafluorobutanimidoyl fluoride |
| SMILES | F/C(=N\OC(F)(C(F)(F)Cl)C(F)(F)Cl)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7Cl2F13NO/c8-5(16,17)4(15,6(9,18)19)24-23-1(10)2(11,12)3(13,14)7(20,21)22/b23-1- |
| InChIKey | IMZGITJIONMYBN-FALCXBHYSA-N |
| XLogP | 5.45 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.96 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|