About 2-[2,2-bis(diethoxyphosphoryl)ethyl]-2,3-dihydroinden-1-one
2-[2,2-bis(diethoxyphosphoryl)ethyl]-2,3-dihydroinden-1-one (PubChem CID 10477908) has the molecular formula C19H30O7P2
and a molecular weight of 432.39 g/mol. Its IUPAC name is 2-[2,2-bis(diethoxyphosphoryl)ethyl]-2,3-dihydroinden-1-one.
Molecular Properties
| Compound Name | 2-[2,2-bis(diethoxyphosphoryl)ethyl]-2,3-dihydroinden-1-one |
| PubChem CID | 10477908 |
| Molecular Formula | C19H30O7P2 |
| Molecular Weight | 432.39 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 2-[2,2-bis(diethoxyphosphoryl)ethyl]-2,3-dihydroinden-1-one |
| SMILES | CCOP(=O)(OCC)C(CC1Cc2ccccc2C1=O)P(=O)(OCC)OCC |
| InChI | InChI=1S/C19H30O7P2/c1-5-23-27(21,24-6-2)18(28(22,25-7-3)26-8-4)14-16-13-15-11-9-10-12-17(15)19(16)20/h9-12,16,18H,5-8,13-14H2,1-4H3 |
| InChIKey | GMPMFNCBLNRJEM-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.39 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-[2,2-bis(diethoxyphosphoryl)ethyl]-2,3-dihydroinden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,2-bis(diethoxyphosphoryl)ethyl]-2,3-dihydroinden-1-one?
The IUPAC name of 2-[2,2-bis(diethoxyphosphoryl)ethyl]-2,3-dihydroinden-1-one (CID 10477908) is 2-[2,2-bis(diethoxyphosphoryl)ethyl]-2,3-dihydroinden-1-one.
What is the SMILES notation for 2-[2,2-bis(diethoxyphosphoryl)ethyl]-2,3-dihydroinden-1-one?
The canonical SMILES for 2-[2,2-bis(diethoxyphosphoryl)ethyl]-2,3-dihydroinden-1-one is CCOP(=O)(OCC)C(CC1Cc2ccccc2C1=O)P(=O)(OCC)OCC.
What is the InChIKey of 2-[2,2-bis(diethoxyphosphoryl)ethyl]-2,3-dihydroinden-1-one?
The InChIKey is GMPMFNCBLNRJEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30O7P2/c1-5-23-27(21,24-6-2)18(28(22,25-7-3)26-8-4)14-16-13-15-11-9-10-12-17(15)19(16)20/h9-12,16,18H,5-8,13-14H2,1-4H3.
What are the key properties of 2-[2,2-bis(diethoxyphosphoryl)ethyl]-2,3-dihydroinden-1-one?
2-[2,2-bis(diethoxyphosphoryl)ethyl]-2,3-dihydroinden-1-one has a molecular weight of 432.39 g/mol, XLogP of 5.29, 12 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,2-bis(diethoxyphosphoryl)ethyl]-2,3-dihydroinden-1-one is sourced from PubChem (CID 10477908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).