C22H32N4O5 — CID 10477928
N,3,5-trimethoxy-4-[6-methoxy-3-methyl-5-(pentan-3-ylamino)pyrazin-2-yl]-N-methylbenzamide (PubChem CID 10477928) has the molecular formula C22H32N4O5 and a molecular weight of 432.52 g/mol. Its IUPAC name is N,3,5-trimethoxy-4-[6-methoxy-3-methyl-5-(pentan-3-ylamino)pyrazin-2-yl]-N-methylbenzamide.
| Compound Name | N,3,5-trimethoxy-4-[6-methoxy-3-methyl-5-(pentan-3-ylamino)pyrazin-2-yl]-N-methylbenzamide |
|---|---|
| PubChem CID | 10477928 |
| Molecular Formula | C22H32N4O5 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | N,3,5-trimethoxy-4-[6-methoxy-3-methyl-5-(pentan-3-ylamino)pyrazin-2-yl]-N-methylbenzamide |
| SMILES | CCC(CC)Nc1nc(C)c(-c2c(OC)cc(C(=O)N(C)OC)cc2OC)nc1OC |
| InChI | InChI=1S/C22H32N4O5/c1-9-15(10-2)24-20-21(30-7)25-19(13(3)23-20)18-16(28-5)11-14(12-17(18)29-6)22(27)26(4)31-8/h11-12,15H,9-10H2,1-8H3,(H,23,24) |
| InChIKey | GTSWMZMERAFAIK-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 95.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|