C26H40O5 — CID 10477940
ethyl (1R,2S,4E,6E,10E,12E,14S,16R)-14-hydroxy-2,5,11,18,18-pentamethyl-17,19-dioxabicyclo[14.3.1]icosa-4,6,10,12-tetraene-2-carboxylate (PubChem CID 10477940) has the molecular formula C26H40O5 and a molecular weight of 432.60 g/mol. Its IUPAC name is ethyl (1R,2S,4E,6E,10E,12E,14S,16R)-14-hydroxy-2,5,11,18,18-pentamethyl-17,19-dioxabicyclo[14.3.1]icosa-4,6,10,12-tetraene-2-carboxylate.
| Compound Name | ethyl (1R,2S,4E,6E,10E,12E,14S,16R)-14-hydroxy-2,5,11,18,18-pentamethyl-17,19-dioxabicyclo[14.3.1]icosa-4,6,10,12-tetraene-2-carboxylate |
|---|---|
| PubChem CID | 10477940 |
| Molecular Formula | C26H40O5 |
| Molecular Weight | 432.60 g/mol |
| Exact Mass | 432.29 |
| IUPAC Name | ethyl (1R,2S,4E,6E,10E,12E,14S,16R)-14-hydroxy-2,5,11,18,18-pentamethyl-17,19-dioxabicyclo[14.3.1]icosa-4,6,10,12-tetraene-2-carboxylate |
| SMILES | CCOC(=O)[C@@]1(C)C/C=C(C)/C=C/CC/C=C(C)/C=C/[C@@H](O)C[C@@H]2C[C@H]1OC(C)(C)O2 |
| InChI | InChI=1S/C26H40O5/c1-7-29-24(28)26(6)16-15-20(3)12-10-8-9-11-19(2)13-14-21(27)17-22-18-23(26)31-25(4,5)30-22/h10-15,21-23,27H,7-9,16-18H2,1-6H3/b12-10+,14-13+,19-11+,20-15+/t21-,22-,23-,26+/m1/s1 |
| InChIKey | UIUPQCZZZLCSSL-HNUSZLJWSA-N |
| XLogP | 5.41 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.60 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |