C10H14Br2N2 — CID 104779492
3-bromo-N-(2-bromoethyl)-N-propylpyridin-4-amine (PubChem CID 104779492) has the molecular formula C10H14Br2N2 and a molecular weight of 322.04 g/mol. Its IUPAC name is 3-bromo-N-(2-bromoethyl)-N-propylpyridin-4-amine.
| Compound Name | 3-bromo-N-(2-bromoethyl)-N-propylpyridin-4-amine |
|---|---|
| PubChem CID | 104779492 |
| Molecular Formula | C10H14Br2N2 |
| Molecular Weight | 322.04 g/mol |
| Exact Mass | 319.95 |
| IUPAC Name | 3-bromo-N-(2-bromoethyl)-N-propylpyridin-4-amine |
| SMILES | CCCN(CCBr)c1ccncc1Br |
| InChI | InChI=1S/C10H14Br2N2/c1-2-6-14(7-4-11)10-3-5-13-8-9(10)12/h3,5,8H,2,4,6-7H2,1H3 |
| InChIKey | HCMNLAPHWGGLTI-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.04 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|