About (3-chlorophenyl)methyl (2S)-2-benzamido-3-(1H-indol-3-yl)propanoate
(3-chlorophenyl)methyl (2S)-2-benzamido-3-(1H-indol-3-yl)propanoate (PubChem CID 10477952) has the molecular formula C25H21ClN2O3
and a molecular weight of 432.91 g/mol. Its IUPAC name is (3-chlorophenyl)methyl (2S)-2-benzamido-3-(1H-indol-3-yl)propanoate.
Molecular Properties
| Compound Name | (3-chlorophenyl)methyl (2S)-2-benzamido-3-(1H-indol-3-yl)propanoate |
| PubChem CID | 10477952 |
| Molecular Formula | C25H21ClN2O3 |
| Molecular Weight | 432.91 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | (3-chlorophenyl)methyl (2S)-2-benzamido-3-(1H-indol-3-yl)propanoate |
| SMILES | O=C(N[C@@H](Cc1c[nH]c2ccccc12)C(=O)OCc1cccc(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C25H21ClN2O3/c26-20-10-6-7-17(13-20)16-31-25(30)23(28-24(29)18-8-2-1-3-9-18)14-19-15-27-22-12-5-4-11-21(19)22/h1-13,15,23,27H,14,16H2,(H,28,29)/t23-/m0/s1 |
| InChIKey | CMVKWSMUPSXKPB-QHCPKHFHSA-N |
| XLogP | 4.91 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.91 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-chlorophenyl)methyl (2S)-2-benzamido-3-(1H-indol-3-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-chlorophenyl)methyl (2S)-2-benzamido-3-(1H-indol-3-yl)propanoate?
The IUPAC name of (3-chlorophenyl)methyl (2S)-2-benzamido-3-(1H-indol-3-yl)propanoate (CID 10477952) is (3-chlorophenyl)methyl (2S)-2-benzamido-3-(1H-indol-3-yl)propanoate.
What is the SMILES notation for (3-chlorophenyl)methyl (2S)-2-benzamido-3-(1H-indol-3-yl)propanoate?
The canonical SMILES for (3-chlorophenyl)methyl (2S)-2-benzamido-3-(1H-indol-3-yl)propanoate is O=C(N[C@@H](Cc1c[nH]c2ccccc12)C(=O)OCc1cccc(Cl)c1)c1ccccc1.
What is the InChIKey of (3-chlorophenyl)methyl (2S)-2-benzamido-3-(1H-indol-3-yl)propanoate?
The InChIKey is CMVKWSMUPSXKPB-QHCPKHFHSA-N. The full InChI is InChI=1S/C25H21ClN2O3/c26-20-10-6-7-17(13-20)16-31-25(30)23(28-24(29)18-8-2-1-3-9-18)14-19-15-27-22-12-5-4-11-21(19)22/h1-13,15,23,27H,14,16H2,(H,28,29)/t23-/m0/s1.
What are the key properties of (3-chlorophenyl)methyl (2S)-2-benzamido-3-(1H-indol-3-yl)propanoate?
(3-chlorophenyl)methyl (2S)-2-benzamido-3-(1H-indol-3-yl)propanoate has a molecular weight of 432.91 g/mol, XLogP of 4.91, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-chlorophenyl)methyl (2S)-2-benzamido-3-(1H-indol-3-yl)propanoate is sourced from PubChem (CID 10477952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).