C18H25ClN2O6S — CID 10477954
4-[2-(2,4-dimethyl-6-propan-2-ylpyridin-1-ium-1-yl)ethyl]benzenesulfonamide perchlorate (PubChem CID 10477954) has the molecular formula C18H25ClN2O6S and a molecular weight of 432.93 g/mol. Its IUPAC name is 4-[2-(2,4-dimethyl-6-propan-2-ylpyridin-1-ium-1-yl)ethyl]benzenesulfonamide perchlorate.
| Compound Name | 4-[2-(2,4-dimethyl-6-propan-2-ylpyridin-1-ium-1-yl)ethyl]benzenesulfonamide perchlorate |
|---|---|
| PubChem CID | 10477954 |
| Molecular Formula | C18H25ClN2O6S |
| Molecular Weight | 432.93 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | 4-[2-(2,4-dimethyl-6-propan-2-ylpyridin-1-ium-1-yl)ethyl]benzenesulfonamide perchlorate |
| SMILES | Cc1cc(C)[n+](CCc2ccc(S(N)(=O)=O)cc2)c(C(C)C)c1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C18H25N2O2S.ClHO4/c1-13(2)18-12-14(3)11-15(4)20(18)10-9-16-5-7-17(8-6-16)23(19,21)22;2-1(3,4)5/h5-8,11-13H,9-10H2,1-4H3,(H2,19,21,22);(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | LRDMJDYQKSQVTK-UHFFFAOYSA-M |
| XLogP | -2.15 |
| TPSA | 156.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.93 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|