C27H34N2O3 — CID 10478067
tert-butyl (6S,8aS)-6-(dibenzylamino)-1-oxo-2,3,5,6,7,8-hexahydroindolizine-8a-carboxylate (PubChem CID 10478067) has the molecular formula C27H34N2O3 and a molecular weight of 434.58 g/mol. Its IUPAC name is tert-butyl (6S,8aS)-6-(dibenzylamino)-1-oxo-2,3,5,6,7,8-hexahydroindolizine-8a-carboxylate.
| Compound Name | tert-butyl (6S,8aS)-6-(dibenzylamino)-1-oxo-2,3,5,6,7,8-hexahydroindolizine-8a-carboxylate |
|---|---|
| PubChem CID | 10478067 |
| Molecular Formula | C27H34N2O3 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.26 |
| IUPAC Name | tert-butyl (6S,8aS)-6-(dibenzylamino)-1-oxo-2,3,5,6,7,8-hexahydroindolizine-8a-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@]12CC[C@H](N(Cc3ccccc3)Cc3ccccc3)CN1CCC2=O |
| InChI | InChI=1S/C27H34N2O3/c1-26(2,3)32-25(31)27-16-14-23(20-29(27)17-15-24(27)30)28(18-21-10-6-4-7-11-21)19-22-12-8-5-9-13-22/h4-13,23H,14-20H2,1-3H3/t23-,27-/m0/s1 |
| InChIKey | YTRYTDJEGWQNIC-HOFKKMOUSA-N |
| XLogP | 4.21 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|