C24H28N4O2S — CID 10478197
2-[3-(3-piperidin-4-ylpropoxy)phenyl]-N-(5-pyrimidin-4-ylthiophen-3-yl)acetamide (PubChem CID 10478197) has the molecular formula C24H28N4O2S and a molecular weight of 436.58 g/mol. Its IUPAC name is 2-[3-(3-piperidin-4-ylpropoxy)phenyl]-N-(5-pyrimidin-4-ylthiophen-3-yl)acetamide.
| Compound Name | 2-[3-(3-piperidin-4-ylpropoxy)phenyl]-N-(5-pyrimidin-4-ylthiophen-3-yl)acetamide |
|---|---|
| PubChem CID | 10478197 |
| Molecular Formula | C24H28N4O2S |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 2-[3-(3-piperidin-4-ylpropoxy)phenyl]-N-(5-pyrimidin-4-ylthiophen-3-yl)acetamide |
| SMILES | O=C(Cc1cccc(OCCCC2CCNCC2)c1)Nc1csc(-c2ccncn2)c1 |
| InChI | InChI=1S/C24H28N4O2S/c29-24(28-20-15-23(31-16-20)22-8-11-26-17-27-22)14-19-3-1-5-21(13-19)30-12-2-4-18-6-9-25-10-7-18/h1,3,5,8,11,13,15-18,25H,2,4,6-7,9-10,12,14H2,(H,28,29) |
| InChIKey | FEHOYYFVVQCLPF-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|